C14H22Cl2NO2+ — CID 2247482
6-(2,4-dichlorophenoxy)hexyl-(2-hydroxyethyl)azanium (PubChem CID 2247482) has the molecular formula C14H22Cl2NO2+ and a molecular weight of 307.24 g/mol. Its IUPAC name is 6-(2,4-dichlorophenoxy)hexyl-(2-hydroxyethyl)azanium.
| Compound Name | 6-(2,4-dichlorophenoxy)hexyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 2247482 |
| Molecular Formula | C14H22Cl2NO2+ |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 6-(2,4-dichlorophenoxy)hexyl-(2-hydroxyethyl)azanium |
| SMILES | OCC[NH2+]CCCCCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H21Cl2NO2/c15-12-5-6-14(13(16)11-12)19-10-4-2-1-3-7-17-8-9-18/h5-6,11,17-18H,1-4,7-10H2/p+1 |
| InChIKey | LOJOHTCWEAWBME-UHFFFAOYSA-O |
| XLogP | 2.49 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|