C14H16Cl2O — CID 126538407
2,4-dichloro-1-oct-7-ynoxybenzene (PubChem CID 126538407) has the molecular formula C14H16Cl2O and a molecular weight of 271.19 g/mol. Its IUPAC name is 2,4-dichloro-1-oct-7-ynoxybenzene.
| Compound Name | 2,4-dichloro-1-oct-7-ynoxybenzene |
|---|---|
| PubChem CID | 126538407 |
| Molecular Formula | C14H16Cl2O |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2,4-dichloro-1-oct-7-ynoxybenzene |
| SMILES | C#CCCCCCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2O/c1-2-3-4-5-6-7-10-17-14-9-8-12(15)11-13(14)16/h1,8-9,11H,3-7,10H2 |
| InChIKey | SDWLJJWVZWDNTE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|