C15H10Cl3NO2 — CID 22682686
5-chloro-2-[2-(2,4-dichlorophenoxy)ethoxy]benzonitrile (PubChem CID 22682686) has the molecular formula C15H10Cl3NO2 and a molecular weight of 342.61 g/mol. Its IUPAC name is 5-chloro-2-[2-(2,4-dichlorophenoxy)ethoxy]benzonitrile.
| Compound Name | 5-chloro-2-[2-(2,4-dichlorophenoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 22682686 |
| Molecular Formula | C15H10Cl3NO2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 5-chloro-2-[2-(2,4-dichlorophenoxy)ethoxy]benzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1OCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl3NO2/c16-11-1-3-14(10(7-11)9-19)20-5-6-21-15-4-2-12(17)8-13(15)18/h1-4,7-8H,5-6H2 |
| InChIKey | FESRQNXUTTUUPQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|