C14H13Cl2NO2 — CID 39418958
2-[2-(2,4-dichlorophenoxy)ethoxy]aniline (PubChem CID 39418958) has the molecular formula C14H13Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)ethoxy]aniline.
| Compound Name | 2-[2-(2,4-dichlorophenoxy)ethoxy]aniline |
|---|---|
| PubChem CID | 39418958 |
| Molecular Formula | C14H13Cl2NO2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-[2-(2,4-dichlorophenoxy)ethoxy]aniline |
| SMILES | Nc1ccccc1OCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2NO2/c15-10-5-6-13(11(16)9-10)18-7-8-19-14-4-2-1-3-12(14)17/h1-6,9H,7-8,17H2 |
| InChIKey | QLKZCJQGTPWVAV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|