C14H16Cl2N2O — CID 19102396
2,5-dichloroaniline;2-ethoxyaniline (PubChem CID 19102396) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 2,5-dichloroaniline;2-ethoxyaniline.
| Compound Name | 2,5-dichloroaniline;2-ethoxyaniline |
|---|---|
| PubChem CID | 19102396 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2,5-dichloroaniline;2-ethoxyaniline |
| SMILES | CCOc1ccccc1N.Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H11NO.C6H5Cl2N/c1-2-10-8-6-4-3-5-7(8)9;7-4-1-2-5(8)6(9)3-4/h3-6H,2,9H2,1H3;1-3H,9H2 |
| InChIKey | UNPBZZIJTLMULL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|