C14H13Cl2NO2 — CID 63675211
4-(2,4-dichlorophenoxy)-2-ethoxyaniline (PubChem CID 63675211) has the molecular formula C14H13Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-2-ethoxyaniline.
| Compound Name | 4-(2,4-dichlorophenoxy)-2-ethoxyaniline |
|---|---|
| PubChem CID | 63675211 |
| Molecular Formula | C14H13Cl2NO2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-2-ethoxyaniline |
| SMILES | CCOc1cc(Oc2ccc(Cl)cc2Cl)ccc1N |
| InChI | InChI=1S/C14H13Cl2NO2/c1-2-18-14-8-10(4-5-12(14)17)19-13-6-3-9(15)7-11(13)16/h3-8H,2,17H2,1H3 |
| InChIKey | VDJIJXXUNSVYJO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|