C9H10Cl2O3 — CID 145046183
2,4-dichloro-1-ethoxybenzene;formic acid (PubChem CID 145046183) has the molecular formula C9H10Cl2O3 and a molecular weight of 237.08 g/mol. Its IUPAC name is 2,4-dichloro-1-ethoxybenzene;formic acid.
| Compound Name | 2,4-dichloro-1-ethoxybenzene;formic acid |
|---|---|
| PubChem CID | 145046183 |
| Molecular Formula | C9H10Cl2O3 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 2,4-dichloro-1-ethoxybenzene;formic acid |
| SMILES | CCOc1ccc(Cl)cc1Cl.O=CO |
| InChI | InChI=1S/C8H8Cl2O.CH2O2/c1-2-11-8-4-3-6(9)5-7(8)10;2-1-3/h3-5H,2H2,1H3;1H,(H,2,3) |
| InChIKey | HZBOLAJFZVSTCJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|