C8H8Cl2O2S — CID 68577849
2,4-dichloro-1-(methylsulfinylmethoxy)benzene (PubChem CID 68577849) has the molecular formula C8H8Cl2O2S and a molecular weight of 239.12 g/mol. Its IUPAC name is 2,4-dichloro-1-(methylsulfinylmethoxy)benzene.
| Compound Name | 2,4-dichloro-1-(methylsulfinylmethoxy)benzene |
|---|---|
| PubChem CID | 68577849 |
| Molecular Formula | C8H8Cl2O2S |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 2,4-dichloro-1-(methylsulfinylmethoxy)benzene |
| SMILES | CS(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2O2S/c1-13(11)5-12-8-3-2-6(9)4-7(8)10/h2-4H,5H2,1H3 |
| InChIKey | NYJOMJVJVSXIRJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |