C8H6Cl2F2O — CID 57262164
2,4-dichloro-1-(2,2-difluoroethoxy)benzene (PubChem CID 57262164) has the molecular formula C8H6Cl2F2O and a molecular weight of 227.04 g/mol. Its IUPAC name is 2,4-dichloro-1-(2,2-difluoroethoxy)benzene.
| Compound Name | 2,4-dichloro-1-(2,2-difluoroethoxy)benzene |
|---|---|
| PubChem CID | 57262164 |
| Molecular Formula | C8H6Cl2F2O |
| Molecular Weight | 227.04 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 2,4-dichloro-1-(2,2-difluoroethoxy)benzene |
| SMILES | FC(F)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2F2O/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3,8H,4H2 |
| InChIKey | XFZYGYYAMBGJPP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.04 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |