C15H14Cl2O3S — CID 19981788
4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]sulfanylphenol (PubChem CID 19981788) has the molecular formula C15H14Cl2O3S and a molecular weight of 345.25 g/mol. Its IUPAC name is 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]sulfanylphenol.
| Compound Name | 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]sulfanylphenol |
|---|---|
| PubChem CID | 19981788 |
| Molecular Formula | C15H14Cl2O3S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]sulfanylphenol |
| SMILES | Oc1ccc(SCC(O)COc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H14Cl2O3S/c16-10-1-6-15(14(17)7-10)20-8-12(19)9-21-13-4-2-11(18)3-5-13/h1-7,12,18-19H,8-9H2 |
| InChIKey | LBGNLBYUOGXGTD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |