C17H20O5S — CID 19981837
4-[3-(3,4-dimethoxyphenoxy)-2-hydroxypropyl]sulfanylphenol (PubChem CID 19981837) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenoxy)-2-hydroxypropyl]sulfanylphenol.
| Compound Name | 4-[3-(3,4-dimethoxyphenoxy)-2-hydroxypropyl]sulfanylphenol |
|---|---|
| PubChem CID | 19981837 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenoxy)-2-hydroxypropyl]sulfanylphenol |
| SMILES | COc1ccc(OCC(O)CSc2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C17H20O5S/c1-20-16-8-5-14(9-17(16)21-2)22-10-13(19)11-23-15-6-3-12(18)4-7-15/h3-9,13,18-19H,10-11H2,1-2H3 |
| InChIKey | PNTDNPIBMILZFG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |