C10H16O9S — CID 175056796
3-(4-hydroxy-3-methoxyphenoxy)propane-1,2-diol;sulfuric acid (PubChem CID 175056796) has the molecular formula C10H16O9S and a molecular weight of 312.30 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxyphenoxy)propane-1,2-diol;sulfuric acid.
| Compound Name | 3-(4-hydroxy-3-methoxyphenoxy)propane-1,2-diol;sulfuric acid |
|---|---|
| PubChem CID | 175056796 |
| Molecular Formula | C10H16O9S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenoxy)propane-1,2-diol;sulfuric acid |
| SMILES | COc1cc(OCC(O)CO)ccc1O.O=S(=O)(O)O |
| InChI | InChI=1S/C10H14O5.H2O4S/c1-14-10-4-8(2-3-9(10)13)15-6-7(12)5-11;1-5(2,3)4/h2-4,7,11-13H,5-6H2,1H3;(H2,1,2,3,4) |
| InChIKey | YWHWNCURFHTVEA-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|