C10H14O7S — CID 132514551
2,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propane-1-sulfonic acid (PubChem CID 132514551) has the molecular formula C10H14O7S and a molecular weight of 278.28 g/mol. Its IUPAC name is 2,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propane-1-sulfonic acid.
| Compound Name | 2,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 132514551 |
| Molecular Formula | C10H14O7S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propane-1-sulfonic acid |
| SMILES | COc1cc(C(C(O)CO)S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C10H14O7S/c1-17-9-4-6(2-3-7(9)12)10(8(13)5-11)18(14,15)16/h2-4,8,10-13H,5H2,1H3,(H,14,15,16) |
| InChIKey | QLLGNVVQCPLKEW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|