C11H16O10S2 — CID 163116555
(1S,2R)-3-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propane-1,2-disulfonic acid (PubChem CID 163116555) has the molecular formula C11H16O10S2 and a molecular weight of 372.37 g/mol. Its IUPAC name is (1S,2R)-3-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propane-1,2-disulfonic acid.
| Compound Name | (1S,2R)-3-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propane-1,2-disulfonic acid |
|---|---|
| PubChem CID | 163116555 |
| Molecular Formula | C11H16O10S2 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | (1S,2R)-3-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propane-1,2-disulfonic acid |
| SMILES | COc1cc([C@@H]([C@@H](CO)S(=O)(=O)O)S(=O)(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C11H16O10S2/c1-20-7-3-6(4-8(21-2)10(7)13)11(23(17,18)19)9(5-12)22(14,15)16/h3-4,9,11-13H,5H2,1-2H3,(H,14,15,16)(H,17,18,19)/t9-,11+/m1/s1 |
| InChIKey | AAFVLPFGNUQZQZ-KOLCDFICSA-N |
| XLogP | -0.41 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|