C10H13BrO3 — CID 134832276
4-(1-bromoethyl)-2,6-dimethoxyphenol (PubChem CID 134832276) has the molecular formula C10H13BrO3 and a molecular weight of 261.12 g/mol. Its IUPAC name is 4-(1-bromoethyl)-2,6-dimethoxyphenol.
| Compound Name | 4-(1-bromoethyl)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 134832276 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 4-(1-bromoethyl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(C(C)Br)cc(OC)c1O |
| InChI | InChI=1S/C10H13BrO3/c1-6(11)7-4-8(13-2)10(12)9(5-7)14-3/h4-6,12H,1-3H3 |
| InChIKey | CQQIDGSKGBTQQI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|