C22H30O10 — CID 162905725
(1S,2S,3R,4S)-1,4-bis(4-hydroxy-3,5-dimethoxyphenyl)-2,3-bis(hydroxymethyl)butane-1,4-diol (PubChem CID 162905725) has the molecular formula C22H30O10 and a molecular weight of 454.47 g/mol. Its IUPAC name is (1S,2S,3R,4S)-1,4-bis(4-hydroxy-3,5-dimethoxyphenyl)-2,3-bis(hydroxymethyl)butane-1,4-diol.
| Compound Name | (1S,2S,3R,4S)-1,4-bis(4-hydroxy-3,5-dimethoxyphenyl)-2,3-bis(hydroxymethyl)butane-1,4-diol |
|---|---|
| PubChem CID | 162905725 |
| Molecular Formula | C22H30O10 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (1S,2S,3R,4S)-1,4-bis(4-hydroxy-3,5-dimethoxyphenyl)-2,3-bis(hydroxymethyl)butane-1,4-diol |
| SMILES | COc1cc([C@@H](O)[C@H](CO)[C@H](CO)[C@H](O)c2cc(OC)c(O)c(OC)c2)cc(OC)c1O |
| InChI | InChI=1S/C22H30O10/c1-29-15-5-11(6-16(30-2)21(15)27)19(25)13(9-23)14(10-24)20(26)12-7-17(31-3)22(28)18(8-12)32-4/h5-8,13-14,19-20,23-28H,9-10H2,1-4H3/t13-,14+,19-,20-/m1/s1 |
| InChIKey | NCFWFZYVJFWRFY-RYMBOPBQSA-N |
| XLogP | 1.12 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |