C11H15N3O5 — CID 170827281
3-azido-1-(4-hydroxy-3,5-dimethoxyphenyl)propane-1,2-diol (PubChem CID 170827281) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 3-azido-1-(4-hydroxy-3,5-dimethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-azido-1-(4-hydroxy-3,5-dimethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827281 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3-azido-1-(4-hydroxy-3,5-dimethoxyphenyl)propane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CN=[N+]=[N-])cc(OC)c1O |
| InChI | InChI=1S/C11H15N3O5/c1-18-8-3-6(4-9(19-2)11(8)17)10(16)7(15)5-13-14-12/h3-4,7,10,15-17H,5H2,1-2H3 |
| InChIKey | FEKRKBCWODGHFP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|