C11H11N3O4 — CID 170826321
5-(3-azido-1,2-dihydroxypropyl)benzene-1,3-dicarbaldehyde (PubChem CID 170826321) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 5-(3-azido-1,2-dihydroxypropyl)benzene-1,3-dicarbaldehyde.
| Compound Name | 5-(3-azido-1,2-dihydroxypropyl)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 170826321 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 5-(3-azido-1,2-dihydroxypropyl)benzene-1,3-dicarbaldehyde |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1cc(C=O)cc(C=O)c1 |
| InChI | InChI=1S/C11H11N3O4/c12-14-13-4-10(17)11(18)9-2-7(5-15)1-8(3-9)6-16/h1-3,5-6,10-11,17-18H,4H2 |
| InChIKey | VOESJTXYAHZEGN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|