C8H10N4O4 — CID 170825785
5-(3-azido-1,2-dihydroxypropyl)-3-hydroxy-1H-pyridin-2-one (PubChem CID 170825785) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 5-(3-azido-1,2-dihydroxypropyl)-3-hydroxy-1H-pyridin-2-one.
| Compound Name | 5-(3-azido-1,2-dihydroxypropyl)-3-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 170825785 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 5-(3-azido-1,2-dihydroxypropyl)-3-hydroxy-1H-pyridin-2-one |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1c[nH]c(=O)c(O)c1 |
| InChI | InChI=1S/C8H10N4O4/c9-12-11-3-6(14)7(15)4-1-5(13)8(16)10-2-4/h1-2,6-7,13-15H,3H2,(H,10,16) |
| InChIKey | FMSMGRCAZYKTEY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|