C8H12N2O4 — CID 170827810
5-(3-amino-1,2-dihydroxypropyl)-3-hydroxy-1H-pyridin-2-one (PubChem CID 170827810) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 5-(3-amino-1,2-dihydroxypropyl)-3-hydroxy-1H-pyridin-2-one.
| Compound Name | 5-(3-amino-1,2-dihydroxypropyl)-3-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 170827810 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-(3-amino-1,2-dihydroxypropyl)-3-hydroxy-1H-pyridin-2-one |
| SMILES | NCC(O)C(O)c1c[nH]c(=O)c(O)c1 |
| InChI | InChI=1S/C8H12N2O4/c9-2-6(12)7(13)4-1-5(11)8(14)10-3-4/h1,3,6-7,11-13H,2,9H2,(H,10,14) |
| InChIKey | FHEGPHBDVDQBBB-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |