C7H10ClN3O — CID 130665503
3-chloro-5-[(1S)-1,2-diaminoethyl]-1H-pyridin-2-one (PubChem CID 130665503) has the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. Its IUPAC name is 3-chloro-5-[(1S)-1,2-diaminoethyl]-1H-pyridin-2-one.
| Compound Name | 3-chloro-5-[(1S)-1,2-diaminoethyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130665503 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 3-chloro-5-[(1S)-1,2-diaminoethyl]-1H-pyridin-2-one |
| SMILES | NC[C@@H](N)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C7H10ClN3O/c8-5-1-4(6(10)2-9)3-11-7(5)12/h1,3,6H,2,9-10H2,(H,11,12)/t6-/m1/s1 |
| InChIKey | QBJPVTUYNWNDNF-ZCFIWIBFSA-N |
| XLogP | -0.01 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |