methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate

C8H13N3O2 — CID 55293233

IUPACmethyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate
SMILESCOC(=O)c1cc(C(N)CN)c[nH]1
InChIInChI=1S/C8H13N3O2/c1-13-8(12)7-2-5(4-11-7)6(10)3-9/h2,4,6,11H,3,9-10H2,1H3
InChIKeyFEUDATCAEMBXPL-UHFFFAOYSA-N
MW183.21 g/mol
LogP-0.24
Rot. Bonds3

About methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate

methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate (PubChem CID 55293233) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate
PubChem CID55293233
Molecular FormulaC8H13N3O2
Molecular Weight183.21 g/mol
Exact Mass183.10
IUPAC Namemethyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate
SMILESCOC(=O)c1cc(C(N)CN)c[nH]1
InChIInChI=1S/C8H13N3O2/c1-13-8(12)7-2-5(4-11-7)6(10)3-9/h2,4,6,11H,3,9-10H2,1H3
InChIKeyFEUDATCAEMBXPL-UHFFFAOYSA-N
XLogP-0.24
TPSA94.13 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.21
LogP ≤ 5-0.24
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate?
The IUPAC name of methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate (CID 55293233) is methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate.
What is the SMILES notation for methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate?
The canonical SMILES for methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate is COC(=O)c1cc(C(N)CN)c[nH]1.
What is the InChIKey of methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate?
The InChIKey is FEUDATCAEMBXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-13-8(12)7-2-5(4-11-7)6(10)3-9/h2,4,6,11H,3,9-10H2,1H3.
What are the key properties of methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate?
methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate has a molecular weight of 183.21 g/mol, XLogP of -0.24, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 55293233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).