C8H13N3O2 — CID 55293233
methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate (PubChem CID 55293233) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55293233 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | methyl 4-(1,2-diaminoethyl)-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(C(N)CN)c[nH]1 |
| InChI | InChI=1S/C8H13N3O2/c1-13-8(12)7-2-5(4-11-7)6(10)3-9/h2,4,6,11H,3,9-10H2,1H3 |
| InChIKey | FEUDATCAEMBXPL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |