C11H13NO5 — CID 71756085
5-(5-methoxycarbonyl-1H-pyrrol-3-yl)-5-oxopentanoic acid (PubChem CID 71756085) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 5-(5-methoxycarbonyl-1H-pyrrol-3-yl)-5-oxopentanoic acid.
| Compound Name | 5-(5-methoxycarbonyl-1H-pyrrol-3-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71756085 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 5-(5-methoxycarbonyl-1H-pyrrol-3-yl)-5-oxopentanoic acid |
| SMILES | COC(=O)c1cc(C(=O)CCCC(=O)O)c[nH]1 |
| InChI | InChI=1S/C11H13NO5/c1-17-11(16)8-5-7(6-12-8)9(13)3-2-4-10(14)15/h5-6,12H,2-4H2,1H3,(H,14,15) |
| InChIKey | XOAOKOREPINNOD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |