C11H9Cl3O3 — CID 24727152
5-oxo-5-(3,4,5-trichlorophenyl)pentanoic acid (PubChem CID 24727152) has the molecular formula C11H9Cl3O3 and a molecular weight of 295.55 g/mol. Its IUPAC name is 5-oxo-5-(3,4,5-trichlorophenyl)pentanoic acid.
| Compound Name | 5-oxo-5-(3,4,5-trichlorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 24727152 |
| Molecular Formula | C11H9Cl3O3 |
| Molecular Weight | 295.55 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 5-oxo-5-(3,4,5-trichlorophenyl)pentanoic acid |
| SMILES | O=C(O)CCCC(=O)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl3O3/c12-7-4-6(5-8(13)11(7)14)9(15)2-1-3-10(16)17/h4-5H,1-3H2,(H,16,17) |
| InChIKey | HYGJITUESKAFIP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|