C14H17ClO4 — CID 58833566
4-(4-butoxy-3-chlorophenyl)-4-oxobutanoic acid (PubChem CID 58833566) has the molecular formula C14H17ClO4 and a molecular weight of 284.74 g/mol. Its IUPAC name is 4-(4-butoxy-3-chlorophenyl)-4-oxobutanoic acid.
| Compound Name | 4-(4-butoxy-3-chlorophenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58833566 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(4-butoxy-3-chlorophenyl)-4-oxobutanoic acid |
| SMILES | CCCCOc1ccc(C(=O)CCC(=O)O)cc1Cl |
| InChI | InChI=1S/C14H17ClO4/c1-2-3-8-19-13-6-4-10(9-11(13)15)12(16)5-7-14(17)18/h4,6,9H,2-3,5,7-8H2,1H3,(H,17,18) |
| InChIKey | RXJZVSBJYUAZCV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|