C18H26ClNO2 — CID 82052898
1-(3-chloro-4-propoxyphenyl)-3-(4-methylpiperidin-1-yl)propan-1-one (PubChem CID 82052898) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is 1-(3-chloro-4-propoxyphenyl)-3-(4-methylpiperidin-1-yl)propan-1-one.
| Compound Name | 1-(3-chloro-4-propoxyphenyl)-3-(4-methylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 82052898 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-(3-chloro-4-propoxyphenyl)-3-(4-methylpiperidin-1-yl)propan-1-one |
| SMILES | CCCOc1ccc(C(=O)CCN2CCC(C)CC2)cc1Cl |
| InChI | InChI=1S/C18H26ClNO2/c1-3-12-22-18-5-4-15(13-16(18)19)17(21)8-11-20-9-6-14(2)7-10-20/h4-5,13-14H,3,6-12H2,1-2H3 |
| InChIKey | NOWDYAZYTJSSRC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |