C8H9Cl2FN2 — CID 66517409
(1S)-1-(3,4-dichloro-5-fluorophenyl)ethane-1,2-diamine (PubChem CID 66517409) has the molecular formula C8H9Cl2FN2 and a molecular weight of 223.08 g/mol. Its IUPAC name is (1S)-1-(3,4-dichloro-5-fluorophenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(3,4-dichloro-5-fluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517409 |
| Molecular Formula | C8H9Cl2FN2 |
| Molecular Weight | 223.08 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | (1S)-1-(3,4-dichloro-5-fluorophenyl)ethane-1,2-diamine |
| SMILES | NC[C@@H](N)c1cc(F)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2FN2/c9-5-1-4(7(13)3-12)2-6(11)8(5)10/h1-2,7H,3,12-13H2/t7-/m1/s1 |
| InChIKey | QNDZXIZXFOTHLV-SSDOTTSWSA-N |
| XLogP | 2.09 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.08 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|