C8H11Cl2F3N2 — CID 71758657
1-(3,4,5-trifluorophenyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 71758657) has the molecular formula C8H11Cl2F3N2 and a molecular weight of 263.09 g/mol. Its IUPAC name is 1-(3,4,5-trifluorophenyl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | 1-(3,4,5-trifluorophenyl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 71758657 |
| Molecular Formula | C8H11Cl2F3N2 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 1-(3,4,5-trifluorophenyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C8H9F3N2.2ClH/c9-5-1-4(7(13)3-12)2-6(10)8(5)11;;/h1-2,7H,3,12-13H2;2*1H |
| InChIKey | XBGNBVDTEPQWGL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|