C8H10F2N2O — CID 55272259
4-(1,2-diaminoethyl)-2,6-difluorophenol (PubChem CID 55272259) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is 4-(1,2-diaminoethyl)-2,6-difluorophenol.
| Compound Name | 4-(1,2-diaminoethyl)-2,6-difluorophenol |
|---|---|
| PubChem CID | 55272259 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-(1,2-diaminoethyl)-2,6-difluorophenol |
| SMILES | NCC(N)c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C8H10F2N2O/c9-5-1-4(7(12)3-11)2-6(10)8(5)13/h1-2,7,13H,3,11-12H2 |
| InChIKey | IORBVKXPJIJHDQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |