C9H13FN2O — CID 55283323
[4-(1,2-diaminoethyl)-2-fluorophenyl]methanol (PubChem CID 55283323) has the molecular formula C9H13FN2O and a molecular weight of 184.21 g/mol. Its IUPAC name is [4-(1,2-diaminoethyl)-2-fluorophenyl]methanol.
| Compound Name | [4-(1,2-diaminoethyl)-2-fluorophenyl]methanol |
|---|---|
| PubChem CID | 55283323 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | [4-(1,2-diaminoethyl)-2-fluorophenyl]methanol |
| SMILES | NCC(N)c1ccc(CO)c(F)c1 |
| InChI | InChI=1S/C9H13FN2O/c10-8-3-6(9(12)4-11)1-2-7(8)5-13/h1-3,9,13H,4-5,11-12H2 |
| InChIKey | PQDPWDATZFPOSL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |