C10H14FN3O — CID 66516971
N-[4-[(1S)-1,2-diaminoethyl]-2-fluorophenyl]acetamide (PubChem CID 66516971) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is N-[4-[(1S)-1,2-diaminoethyl]-2-fluorophenyl]acetamide.
| Compound Name | N-[4-[(1S)-1,2-diaminoethyl]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 66516971 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-[4-[(1S)-1,2-diaminoethyl]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc([C@H](N)CN)cc1F |
| InChI | InChI=1S/C10H14FN3O/c1-6(15)14-10-3-2-7(4-8(10)11)9(13)5-12/h2-4,9H,5,12-13H2,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | QKZPASNCEYHKAH-SECBINFHSA-N |
| XLogP | 0.74 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |