C10H15N3O — CID 66516552
N-[3-[(1S)-1,2-diaminoethyl]phenyl]acetamide (PubChem CID 66516552) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N-[3-[(1S)-1,2-diaminoethyl]phenyl]acetamide.
| Compound Name | N-[3-[(1S)-1,2-diaminoethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 66516552 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-[3-[(1S)-1,2-diaminoethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc([C@H](N)CN)c1 |
| InChI | InChI=1S/C10H15N3O/c1-7(14)13-9-4-2-3-8(5-9)10(12)6-11/h2-5,10H,6,11-12H2,1H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | CEVWPUVLRMFDEX-SNVBAGLBSA-N |
| XLogP | 0.60 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |