C10H11F3N2O — CID 66510191
N-[3-[(1R)-1-amino-2,2,2-trifluoroethyl]phenyl]acetamide (PubChem CID 66510191) has the molecular formula C10H11F3N2O and a molecular weight of 232.21 g/mol. Its IUPAC name is N-[3-[(1R)-1-amino-2,2,2-trifluoroethyl]phenyl]acetamide.
| Compound Name | N-[3-[(1R)-1-amino-2,2,2-trifluoroethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 66510191 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-[3-[(1R)-1-amino-2,2,2-trifluoroethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc([C@@H](N)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O/c1-6(16)15-8-4-2-3-7(5-8)9(14)10(11,12)13/h2-5,9H,14H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | FMVNKKIQMQRKNW-SECBINFHSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |