C10H10F3NO2 — CID 66511365
methyl 3-[(1S)-1-amino-2,2,2-trifluoroethyl]benzoate (PubChem CID 66511365) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is methyl 3-[(1S)-1-amino-2,2,2-trifluoroethyl]benzoate.
| Compound Name | methyl 3-[(1S)-1-amino-2,2,2-trifluoroethyl]benzoate |
|---|---|
| PubChem CID | 66511365 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | methyl 3-[(1S)-1-amino-2,2,2-trifluoroethyl]benzoate |
| SMILES | COC(=O)c1cccc([C@H](N)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3NO2/c1-16-9(15)7-4-2-3-6(5-7)8(14)10(11,12)13/h2-5,8H,14H2,1H3/t8-/m0/s1 |
| InChIKey | ODJQEJKSUUUMDV-QMMMGPOBSA-N |
| XLogP | 2.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |