C10H12ClF2NO2 — CID 171250948
methyl 3-[(1S)-1-amino-2,2-difluoroethyl]benzoate;hydrochloride (PubChem CID 171250948) has the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. Its IUPAC name is methyl 3-[(1S)-1-amino-2,2-difluoroethyl]benzoate;hydrochloride.
| Compound Name | methyl 3-[(1S)-1-amino-2,2-difluoroethyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 171250948 |
| Molecular Formula | C10H12ClF2NO2 |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | methyl 3-[(1S)-1-amino-2,2-difluoroethyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1cccc([C@H](N)C(F)F)c1.Cl |
| InChI | InChI=1S/C10H11F2NO2.ClH/c1-15-10(14)7-4-2-3-6(5-7)8(13)9(11)12;/h2-5,8-9H,13H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | XFWXIGXSGNAPJC-QRPNPIFTSA-N |
| XLogP | 2.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |