C10H11F2NO2 — CID 171250947
methyl 3-[(1S)-1-amino-2,2-difluoroethyl]benzoate (PubChem CID 171250947) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is methyl 3-[(1S)-1-amino-2,2-difluoroethyl]benzoate.
| Compound Name | methyl 3-[(1S)-1-amino-2,2-difluoroethyl]benzoate |
|---|---|
| PubChem CID | 171250947 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | methyl 3-[(1S)-1-amino-2,2-difluoroethyl]benzoate |
| SMILES | COC(=O)c1cccc([C@H](N)C(F)F)c1 |
| InChI | InChI=1S/C10H11F2NO2/c1-15-10(14)7-4-2-3-6(5-7)8(13)9(11)12/h2-5,8-9H,13H2,1H3/t8-/m0/s1 |
| InChIKey | GGNAFPWYKNWJTP-QMMMGPOBSA-N |
| XLogP | 1.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |