C8H11FN2O — CID 55283589
5-(1,2-diaminoethyl)-2-fluorophenol (PubChem CID 55283589) has the molecular formula C8H11FN2O and a molecular weight of 170.19 g/mol. Its IUPAC name is 5-(1,2-diaminoethyl)-2-fluorophenol.
| Compound Name | 5-(1,2-diaminoethyl)-2-fluorophenol |
|---|---|
| PubChem CID | 55283589 |
| Molecular Formula | C8H11FN2O |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 5-(1,2-diaminoethyl)-2-fluorophenol |
| SMILES | NCC(N)c1ccc(F)c(O)c1 |
| InChI | InChI=1S/C8H11FN2O/c9-6-2-1-5(3-8(6)12)7(11)4-10/h1-3,7,12H,4,10-11H2 |
| InChIKey | QLPDCVPPYQJPJK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |