C12H19N3O — CID 171226174
N-[4-[(1S)-1,4-diaminobutyl]phenyl]acetamide (PubChem CID 171226174) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[4-[(1S)-1,4-diaminobutyl]phenyl]acetamide.
| Compound Name | N-[4-[(1S)-1,4-diaminobutyl]phenyl]acetamide |
|---|---|
| PubChem CID | 171226174 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-[4-[(1S)-1,4-diaminobutyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc([C@@H](N)CCCN)cc1 |
| InChI | InChI=1S/C12H19N3O/c1-9(16)15-11-6-4-10(5-7-11)12(14)3-2-8-13/h4-7,12H,2-3,8,13-14H2,1H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | DILBNDSGWCKAKR-LBPRGKRZSA-N |
| XLogP | 1.38 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |