C10H13FN2O — CID 130059747
N-[4-(1-amino-2-fluoroethyl)phenyl]acetamide (PubChem CID 130059747) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is N-[4-(1-amino-2-fluoroethyl)phenyl]acetamide.
| Compound Name | N-[4-(1-amino-2-fluoroethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 130059747 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-[4-(1-amino-2-fluoroethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(N)CF)cc1 |
| InChI | InChI=1S/C10H13FN2O/c1-7(14)13-9-4-2-8(3-5-9)10(12)6-11/h2-5,10H,6,12H2,1H3,(H,13,14) |
| InChIKey | LQUJCBXTSZYRCF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |