C19H20N2O4 — CID 20632812
3,3-bis(4-acetamidophenyl)propanoic acid (PubChem CID 20632812) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3,3-bis(4-acetamidophenyl)propanoic acid.
| Compound Name | 3,3-bis(4-acetamidophenyl)propanoic acid |
|---|---|
| PubChem CID | 20632812 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3,3-bis(4-acetamidophenyl)propanoic acid |
| SMILES | CC(=O)Nc1ccc(C(CC(=O)O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-12(22)20-16-7-3-14(4-8-16)18(11-19(24)25)15-5-9-17(10-6-15)21-13(2)23/h3-10,18H,11H2,1-2H3,(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | QIVSJWCDVLUJTO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |