C12H14BrNO3 — CID 82351983
4-(4-acetamidophenyl)-3-bromobutanoic acid (PubChem CID 82351983) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 4-(4-acetamidophenyl)-3-bromobutanoic acid.
| Compound Name | 4-(4-acetamidophenyl)-3-bromobutanoic acid |
|---|---|
| PubChem CID | 82351983 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 4-(4-acetamidophenyl)-3-bromobutanoic acid |
| SMILES | CC(=O)Nc1ccc(CC(Br)CC(=O)O)cc1 |
| InChI | InChI=1S/C12H14BrNO3/c1-8(15)14-11-4-2-9(3-5-11)6-10(13)7-12(16)17/h2-5,10H,6-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | UYWOIPMIYRBRTO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|