C10H12BrNO2 — CID 22563212
N-[4-(2-bromo-1-hydroxyethyl)phenyl]acetamide (PubChem CID 22563212) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is N-[4-(2-bromo-1-hydroxyethyl)phenyl]acetamide.
| Compound Name | N-[4-(2-bromo-1-hydroxyethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 22563212 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | N-[4-(2-bromo-1-hydroxyethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(O)CBr)cc1 |
| InChI | InChI=1S/C10H12BrNO2/c1-7(13)12-9-4-2-8(3-5-9)10(14)6-11/h2-5,10,14H,6H2,1H3,(H,12,13) |
| InChIKey | FKEBVMGNMWCQKA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|