C11H14ClNO3 — CID 171862528
N-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]acetamide (PubChem CID 171862528) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is N-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]acetamide.
| Compound Name | N-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]acetamide |
|---|---|
| PubChem CID | 171862528 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(O)C(O)CCl)cc1 |
| InChI | InChI=1S/C11H14ClNO3/c1-7(14)13-9-4-2-8(3-5-9)11(16)10(15)6-12/h2-5,10-11,15-16H,6H2,1H3,(H,13,14) |
| InChIKey | PODXOMBXZMKHBM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|