C12H16ClNO3 — CID 171894292
N-[3-(4-chloro-1,2-dihydroxybutyl)phenyl]acetamide (PubChem CID 171894292) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is N-[3-(4-chloro-1,2-dihydroxybutyl)phenyl]acetamide.
| Compound Name | N-[3-(4-chloro-1,2-dihydroxybutyl)phenyl]acetamide |
|---|---|
| PubChem CID | 171894292 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-[3-(4-chloro-1,2-dihydroxybutyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(O)C(O)CCCl)c1 |
| InChI | InChI=1S/C12H16ClNO3/c1-8(15)14-10-4-2-3-9(7-10)12(17)11(16)5-6-13/h2-4,7,11-12,16-17H,5-6H2,1H3,(H,14,15) |
| InChIKey | ZXBNDVABODWZLL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|