C11H17N3O3 — CID 171858335
[3-[1,2-dihydroxy-3-(methylamino)propyl]phenyl]urea (PubChem CID 171858335) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is [3-[1,2-dihydroxy-3-(methylamino)propyl]phenyl]urea.
| Compound Name | [3-[1,2-dihydroxy-3-(methylamino)propyl]phenyl]urea |
|---|---|
| PubChem CID | 171858335 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [3-[1,2-dihydroxy-3-(methylamino)propyl]phenyl]urea |
| SMILES | CNCC(O)C(O)c1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C11H17N3O3/c1-13-6-9(15)10(16)7-3-2-4-8(5-7)14-11(12)17/h2-5,9-10,13,15-16H,6H2,1H3,(H3,12,14,17) |
| InChIKey | WOLFPXBYVSEALS-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |