C11H14ClNO3S — CID 170820573
2-chloro-N-[4-(1,2-dihydroxy-3-sulfanylpropyl)phenyl]acetamide (PubChem CID 170820573) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is 2-chloro-N-[4-(1,2-dihydroxy-3-sulfanylpropyl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-(1,2-dihydroxy-3-sulfanylpropyl)phenyl]acetamide |
|---|---|
| PubChem CID | 170820573 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-chloro-N-[4-(1,2-dihydroxy-3-sulfanylpropyl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(C(O)C(O)CS)cc1 |
| InChI | InChI=1S/C11H14ClNO3S/c12-5-10(15)13-8-3-1-7(2-4-8)11(16)9(14)6-17/h1-4,9,11,14,16-17H,5-6H2,(H,13,15) |
| InChIKey | NRJPMHRTZWLTEC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|