C14H19NO4S — CID 171875060
N-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-3-oxobutanamide (PubChem CID 171875060) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-3-oxobutanamide.
| Compound Name | N-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 171875060 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[4-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccc(C(O)C(O)CCS)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-9(16)8-13(18)15-11-4-2-10(3-5-11)14(19)12(17)6-7-20/h2-5,12,14,17,19-20H,6-8H2,1H3,(H,15,18) |
| InChIKey | PLQVDHKDQACMMX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|