C12H15ClO3S — CID 171874414
1-[2-chloro-5-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]ethanone (PubChem CID 171874414) has the molecular formula C12H15ClO3S and a molecular weight of 274.77 g/mol. Its IUPAC name is 1-[2-chloro-5-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]ethanone.
| Compound Name | 1-[2-chloro-5-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171874414 |
| Molecular Formula | C12H15ClO3S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-[2-chloro-5-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(C(O)C(O)CCS)ccc1Cl |
| InChI | InChI=1S/C12H15ClO3S/c1-7(14)9-6-8(2-3-10(9)13)12(16)11(15)4-5-17/h2-3,6,11-12,15-17H,4-5H2,1H3 |
| InChIKey | UYZWAHOLBULTCG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|