5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid

C11H14ClNO4 — CID 171881516

IUPAC5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid
SMILESNCCC(O)C(O)c1ccc(Cl)c(C(=O)O)c1
InChIInChI=1S/C11H14ClNO4/c12-8-2-1-6(5-7(8)11(16)17)10(15)9(14)3-4-13/h1-2,5,9-10,14-15H,3-4,13H2,(H,16,17)
InChIKeyRIHWNZIDIPDZQE-UHFFFAOYSA-N
MW259.69 g/mol
LogP0.78
Rot. Bonds5

About 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid

5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid (PubChem CID 171881516) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid.

Molecular Properties

Compound Name5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid
PubChem CID171881516
Molecular FormulaC11H14ClNO4
Molecular Weight259.69 g/mol
Exact Mass259.06
IUPAC Name5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid
SMILESNCCC(O)C(O)c1ccc(Cl)c(C(=O)O)c1
InChIInChI=1S/C11H14ClNO4/c12-8-2-1-6(5-7(8)11(16)17)10(15)9(14)3-4-13/h1-2,5,9-10,14-15H,3-4,13H2,(H,16,17)
InChIKeyRIHWNZIDIPDZQE-UHFFFAOYSA-N
XLogP0.78
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.69
LogP ≤ 50.78
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid?
The IUPAC name of 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid (CID 171881516) is 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid.
What is the SMILES notation for 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid?
The canonical SMILES for 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid is NCCC(O)C(O)c1ccc(Cl)c(C(=O)O)c1.
What is the InChIKey of 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid?
The InChIKey is RIHWNZIDIPDZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO4/c12-8-2-1-6(5-7(8)11(16)17)10(15)9(14)3-4-13/h1-2,5,9-10,14-15H,3-4,13H2,(H,16,17).
What are the key properties of 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid?
5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid has a molecular weight of 259.69 g/mol, XLogP of 0.78, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-amino-1,2-dihydroxybutyl)-2-chlorobenzoic acid is sourced from PubChem (CID 171881516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).