C12H14BrClO3 — CID 171892331
1-[5-(4-bromo-1,2-dihydroxybutyl)-2-chlorophenyl]ethanone (PubChem CID 171892331) has the molecular formula C12H14BrClO3 and a molecular weight of 321.60 g/mol. Its IUPAC name is 1-[5-(4-bromo-1,2-dihydroxybutyl)-2-chlorophenyl]ethanone.
| Compound Name | 1-[5-(4-bromo-1,2-dihydroxybutyl)-2-chlorophenyl]ethanone |
|---|---|
| PubChem CID | 171892331 |
| Molecular Formula | C12H14BrClO3 |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 1-[5-(4-bromo-1,2-dihydroxybutyl)-2-chlorophenyl]ethanone |
| SMILES | CC(=O)c1cc(C(O)C(O)CCBr)ccc1Cl |
| InChI | InChI=1S/C12H14BrClO3/c1-7(15)9-6-8(2-3-10(9)14)12(17)11(16)4-5-13/h2-3,6,11-12,16-17H,4-5H2,1H3 |
| InChIKey | HXDTZLCFCQFKTQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|